C19H14Cl2N2O5 — CID 92542127
(3aR,6aR)-5-(2,5-dichlorophenyl)-3-(2,4-dimethoxyphenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 92542127) has the molecular formula C19H14Cl2N2O5 and a molecular weight of 421.24 g/mol. Its IUPAC name is (3aR,6aR)-5-(2,5-dichlorophenyl)-3-(2,4-dimethoxyphenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aR,6aR)-5-(2,5-dichlorophenyl)-3-(2,4-dimethoxyphenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 92542127 |
| Molecular Formula | C19H14Cl2N2O5 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | (3aR,6aR)-5-(2,5-dichlorophenyl)-3-(2,4-dimethoxyphenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc(C2=NO[C@H]3C(=O)N(c4cc(Cl)ccc4Cl)C(=O)[C@H]23)c(OC)c1 |
| InChI | InChI=1S/C19H14Cl2N2O5/c1-26-10-4-5-11(14(8-10)27-2)16-15-17(28-22-16)19(25)23(18(15)24)13-7-9(20)3-6-12(13)21/h3-8,15,17H,1-2H3/t15-,17-/m1/s1 |
| InChIKey | VKUQRBISRFOJKN-NVXWUHKLSA-N |
| XLogP | 3.30 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|