C15H20O6 — CID 92543360
dimethyl (1R,3S,5R,7R)-1,5-dimethyl-2,6-dioxobicyclo[3.3.1]nonane-3,7-dicarboxylate (PubChem CID 92543360) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is dimethyl (1R,3S,5R,7R)-1,5-dimethyl-2,6-dioxobicyclo[3.3.1]nonane-3,7-dicarboxylate.
| Compound Name | dimethyl (1R,3S,5R,7R)-1,5-dimethyl-2,6-dioxobicyclo[3.3.1]nonane-3,7-dicarboxylate |
|---|---|
| PubChem CID | 92543360 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | dimethyl (1R,3S,5R,7R)-1,5-dimethyl-2,6-dioxobicyclo[3.3.1]nonane-3,7-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@]2(C)C[C@@](C)(C[C@@H](C(=O)OC)C2=O)C1=O |
| InChI | InChI=1S/C15H20O6/c1-14-5-8(12(18)20-3)11(17)15(2,7-14)6-9(10(14)16)13(19)21-4/h8-9H,5-7H2,1-4H3/t8-,9+,14-,15-/m1/s1 |
| InChIKey | JVFSSAWZIPKBLE-WUEYEGCSSA-N |
| XLogP | 0.91 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|