About 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole
1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole (PubChem CID 92544873) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole.
Molecular Properties
| Compound Name | 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole |
| PubChem CID | 92544873 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole |
| SMILES | Cc1nc2c(n1C)CCN2 |
| InChI | InChI=1S/C7H11N3/c1-5-9-7-6(10(5)2)3-4-8-7/h8H,3-4H2,1-2H3 |
| InChIKey | DIWLTZPQWPMYPS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole?
The IUPAC name of 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole (CID 92544873) is 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole.
What is the SMILES notation for 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole?
The canonical SMILES for 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole is Cc1nc2c(n1C)CCN2.
What is the InChIKey of 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole?
The InChIKey is DIWLTZPQWPMYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-5-9-7-6(10(5)2)3-4-8-7/h8H,3-4H2,1-2H3.
What are the key properties of 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole?
1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole has a molecular weight of 137.19 g/mol, XLogP of 0.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-5,6-dihydro-4H-pyrrolo[2,3-d]imidazole is sourced from PubChem (CID 92544873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).