C18H21ClN2O4 — CID 92548714
2-(7-chloro-5-oxospiro[3H-1,4-benzoxazepine-2,4'-oxane]-4-yl)-N-prop-2-enylacetamide (PubChem CID 92548714) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 2-(7-chloro-5-oxospiro[3H-1,4-benzoxazepine-2,4'-oxane]-4-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(7-chloro-5-oxospiro[3H-1,4-benzoxazepine-2,4'-oxane]-4-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 92548714 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(7-chloro-5-oxospiro[3H-1,4-benzoxazepine-2,4'-oxane]-4-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CC2(CCOCC2)Oc2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C18H21ClN2O4/c1-2-7-20-16(22)11-21-12-18(5-8-24-9-6-18)25-15-4-3-13(19)10-14(15)17(21)23/h2-4,10H,1,5-9,11-12H2,(H,20,22) |
| InChIKey | BAUBOYZFBJYLPR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|