C22H29N5O3 — CID 92549465
11-acetyl-5-[(2R)-1-(cyclopentanecarbonyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 92549465) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 11-acetyl-5-[(2R)-1-(cyclopentanecarbonyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-acetyl-5-[(2R)-1-(cyclopentanecarbonyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 92549465 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 11-acetyl-5-[(2R)-1-(cyclopentanecarbonyl)piperidin-2-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(=O)N1CCc2nc3cc([C@H]4CCCCN4C(=O)C4CCCC4)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C22H29N5O3/c1-14(28)25-11-9-17-16(13-25)22(30)27-20(23-17)12-18(24-27)19-8-4-5-10-26(19)21(29)15-6-2-3-7-15/h12,15,19,24H,2-11,13H2,1H3/t19-/m1/s1 |
| InChIKey | JYIZZODTAHOKPM-LJQANCHMSA-N |
| XLogP | 2.17 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |