C21H25N3O4 — CID 92551250
(3R,4R,5S)-3-methyl-2,6-dioxo-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 92551250) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (3R,4R,5S)-3-methyl-2,6-dioxo-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (3R,4R,5S)-3-methyl-2,6-dioxo-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 92551250 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (3R,4R,5S)-3-methyl-2,6-dioxo-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1[C@@H]2C(=O)Nc3ccccc3C(=O)[C@]12C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H25N3O4/c1-12(20(28)24-10-6-3-7-11-24)22-18(26)15-16-19(27)23-14-9-5-4-8-13(14)17(25)21(15,16)2/h4-5,8-9,12,15-16H,3,6-7,10-11H2,1-2H3,(H,22,26)(H,23,27)/t12-,15-,16+,21+/m0/s1 |
| InChIKey | CSCBAJSKFIASFP-SLPPQORSSA-N |
| XLogP | 1.59 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |