C22H31N3O4 — CID 92551471
(2R)-N-[3-(dimethylamino)propyl]-2-[(2R)-2',4-dioxospiro[3H-chromene-2,5'-azepane]-1'-yl]propanamide (PubChem CID 92551471) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is (2R)-N-[3-(dimethylamino)propyl]-2-[(2R)-2',4-dioxospiro[3H-chromene-2,5'-azepane]-1'-yl]propanamide.
| Compound Name | (2R)-N-[3-(dimethylamino)propyl]-2-[(2R)-2',4-dioxospiro[3H-chromene-2,5'-azepane]-1'-yl]propanamide |
|---|---|
| PubChem CID | 92551471 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (2R)-N-[3-(dimethylamino)propyl]-2-[(2R)-2',4-dioxospiro[3H-chromene-2,5'-azepane]-1'-yl]propanamide |
| SMILES | C[C@H](C(=O)NCCCN(C)C)N1CC[C@]2(CCC1=O)CC(=O)c1ccccc1O2 |
| InChI | InChI=1S/C22H31N3O4/c1-16(21(28)23-12-6-13-24(2)3)25-14-11-22(10-9-20(25)27)15-18(26)17-7-4-5-8-19(17)29-22/h4-5,7-8,16H,6,9-15H2,1-3H3,(H,23,28)/t16-,22-/m1/s1 |
| InChIKey | LMEGPWUXKKMBJU-OPAMFIHVSA-N |
| XLogP | 1.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|