C22H31N5O4 — CID 92551710
5-[(3S)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-11-(2-methoxyacetyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 92551710) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 5-[(3S)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-11-(2-methoxyacetyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-[(3S)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-11-(2-methoxyacetyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 92551710 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 5-[(3S)-1-(2,2-dimethylpropanoyl)piperidin-3-yl]-11-(2-methoxyacetyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | COCC(=O)N1CCc2nc3cc([C@H]4CCCN(C(=O)C(C)(C)C)C4)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C22H31N5O4/c1-22(2,3)21(30)26-8-5-6-14(11-26)17-10-18-23-16-7-9-25(19(28)13-31-4)12-15(16)20(29)27(18)24-17/h10,14,24H,5-9,11-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | BYRDGEWRVLKPQR-AWEZNQCLSA-N |
| XLogP | 1.31 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |