C24H30N2O2 — CID 92552183
(6S)-1-(3,3-dimethylbutanoyl)-6-[(2-phenylphenyl)methyl]-1,4-diazepan-5-one (PubChem CID 92552183) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (6S)-1-(3,3-dimethylbutanoyl)-6-[(2-phenylphenyl)methyl]-1,4-diazepan-5-one.
| Compound Name | (6S)-1-(3,3-dimethylbutanoyl)-6-[(2-phenylphenyl)methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92552183 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (6S)-1-(3,3-dimethylbutanoyl)-6-[(2-phenylphenyl)methyl]-1,4-diazepan-5-one |
| SMILES | CC(C)(C)CC(=O)N1CCNC(=O)[C@@H](Cc2ccccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C24H30N2O2/c1-24(2,3)16-22(27)26-14-13-25-23(28)20(17-26)15-19-11-7-8-12-21(19)18-9-5-4-6-10-18/h4-12,20H,13-17H2,1-3H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | LIMFCDOVSVZUBF-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |