C24H34N6O — CID 92553350
[(5aS,8aR)-1-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]-2,5,6,7,8,8a-hexahydrocyclopenta[b]azepin-5a-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 92553350) has the molecular formula C24H34N6O and a molecular weight of 422.58 g/mol. Its IUPAC name is [(5aS,8aR)-1-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]-2,5,6,7,8,8a-hexahydrocyclopenta[b]azepin-5a-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(5aS,8aR)-1-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]-2,5,6,7,8,8a-hexahydrocyclopenta[b]azepin-5a-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 92553350 |
| Molecular Formula | C24H34N6O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | [(5aS,8aR)-1-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl]-2,5,6,7,8,8a-hexahydrocyclopenta[b]azepin-5a-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | Cc1cc(C)n2ncc(CN3CC=CC[C@@]4(C(=O)N5CCN(C)CC5)CCC[C@@H]34)c2n1 |
| InChI | InChI=1S/C24H34N6O/c1-18-15-19(2)30-22(26-18)20(16-25-30)17-29-10-5-4-8-24(9-6-7-21(24)29)23(31)28-13-11-27(3)12-14-28/h4-5,15-16,21H,6-14,17H2,1-3H3/t21-,24-/m1/s1 |
| InChIKey | JGWRIBNLBVEJIZ-ZJSXRUAMSA-N |
| XLogP | 2.42 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|