C24H30N4O3 — CID 92555791
(1S,13R)-16-[(4-methoxy-3-propan-2-yloxyphenyl)methyl]-7-methyl-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one (PubChem CID 92555791) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is (1S,13R)-16-[(4-methoxy-3-propan-2-yloxyphenyl)methyl]-7-methyl-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one.
| Compound Name | (1S,13R)-16-[(4-methoxy-3-propan-2-yloxyphenyl)methyl]-7-methyl-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one |
|---|---|
| PubChem CID | 92555791 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (1S,13R)-16-[(4-methoxy-3-propan-2-yloxyphenyl)methyl]-7-methyl-4,8,9,16-tetrazatetracyclo[11.2.1.03,11.05,9]hexadeca-3(11),4,6-trien-10-one |
| SMILES | COc1ccc(CN2[C@@H]3CC[C@H]2Cc2nc4cc(C)[nH]n4c(=O)c2C3)cc1OC(C)C |
| InChI | InChI=1S/C24H30N4O3/c1-14(2)31-22-10-16(5-8-21(22)30-4)13-27-17-6-7-18(27)12-20-19(11-17)24(29)28-23(25-20)9-15(3)26-28/h5,8-10,14,17-18,26H,6-7,11-13H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | GFMJEJZJEXWSGA-MSOLQXFVSA-N |
| XLogP | 3.26 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |