C24H33N3O — CID 92556031
4-(azepan-1-yl)-N-[(R)-(2,5-dimethylphenyl)-pyridin-4-ylmethyl]butanamide (PubChem CID 92556031) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[(R)-(2,5-dimethylphenyl)-pyridin-4-ylmethyl]butanamide.
| Compound Name | 4-(azepan-1-yl)-N-[(R)-(2,5-dimethylphenyl)-pyridin-4-ylmethyl]butanamide |
|---|---|
| PubChem CID | 92556031 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 4-(azepan-1-yl)-N-[(R)-(2,5-dimethylphenyl)-pyridin-4-ylmethyl]butanamide |
| SMILES | Cc1ccc(C)c([C@H](NC(=O)CCCN2CCCCCC2)c2ccncc2)c1 |
| InChI | InChI=1S/C24H33N3O/c1-19-9-10-20(2)22(18-19)24(21-11-13-25-14-12-21)26-23(28)8-7-17-27-15-5-3-4-6-16-27/h9-14,18,24H,3-8,15-17H2,1-2H3,(H,26,28)/t24-/m1/s1 |
| InChIKey | XFYLRCDGTONMDR-XMMPIXPASA-N |
| XLogP | 4.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |