C20H24N2O — CID 92556125
(6R)-6-[[2-(2,4-dimethylphenyl)phenyl]methyl]-1,4-diazepan-5-one (PubChem CID 92556125) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (6R)-6-[[2-(2,4-dimethylphenyl)phenyl]methyl]-1,4-diazepan-5-one.
| Compound Name | (6R)-6-[[2-(2,4-dimethylphenyl)phenyl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 92556125 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (6R)-6-[[2-(2,4-dimethylphenyl)phenyl]methyl]-1,4-diazepan-5-one |
| SMILES | Cc1ccc(-c2ccccc2C[C@@H]2CNCCNC2=O)c(C)c1 |
| InChI | InChI=1S/C20H24N2O/c1-14-7-8-18(15(2)11-14)19-6-4-3-5-16(19)12-17-13-21-9-10-22-20(17)23/h3-8,11,17,21H,9-10,12-13H2,1-2H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | RCSMHWAWLWJOCQ-QGZVFWFLSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |