C24H25N3 — CID 92556871
(2R,4S)-2,4,6-tribenzyl-1,3,5-triazabicyclo[3.1.0]hexane (PubChem CID 92556871) has the molecular formula C24H25N3 and a molecular weight of 355.49 g/mol. Its IUPAC name is (2R,4S)-2,4,6-tribenzyl-1,3,5-triazabicyclo[3.1.0]hexane.
| Compound Name | (2R,4S)-2,4,6-tribenzyl-1,3,5-triazabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 92556871 |
| Molecular Formula | C24H25N3 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (2R,4S)-2,4,6-tribenzyl-1,3,5-triazabicyclo[3.1.0]hexane |
| SMILES | c1ccc(CC2N3[C@H](Cc4ccccc4)N[C@H](Cc4ccccc4)N23)cc1 |
| InChI | InChI=1S/C24H25N3/c1-4-10-19(11-5-1)16-22-25-23(17-20-12-6-2-7-13-20)27-24(26(22)27)18-21-14-8-3-9-15-21/h1-15,22-25H,16-18H2/t22-,23+,24?,26?,27? |
| InChIKey | FLEMRTPTNCXWLO-FBGVFJRTSA-N |
| XLogP | 3.83 |
| TPSA | 18.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|