C26H27N3O2 — CID 92558246
(3R)-3-[[4-(4-methylphenyl)phenyl]methyl]-1-(pyridine-2-carbonyl)piperidine-3-carboxamide (PubChem CID 92558246) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (3R)-3-[[4-(4-methylphenyl)phenyl]methyl]-1-(pyridine-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-3-[[4-(4-methylphenyl)phenyl]methyl]-1-(pyridine-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92558246 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (3R)-3-[[4-(4-methylphenyl)phenyl]methyl]-1-(pyridine-2-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C[C@]3(C(N)=O)CCCN(C(=O)c4ccccn4)C3)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O2/c1-19-6-10-21(11-7-19)22-12-8-20(9-13-22)17-26(25(27)31)14-4-16-29(18-26)24(30)23-5-2-3-15-28-23/h2-3,5-13,15H,4,14,16-18H2,1H3,(H2,27,31)/t26-/m1/s1 |
| InChIKey | QTIPDBFHJFWPBP-AREMUKBSSA-N |
| XLogP | 4.01 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |