C20H24N6O2 — CID 92558560
N-tert-butyl-2-[10-(4-methylphenyl)-7-oxo-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl]acetamide (PubChem CID 92558560) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-tert-butyl-2-[10-(4-methylphenyl)-7-oxo-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl]acetamide.
| Compound Name | N-tert-butyl-2-[10-(4-methylphenyl)-7-oxo-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl]acetamide |
|---|---|
| PubChem CID | 92558560 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-tert-butyl-2-[10-(4-methylphenyl)-7-oxo-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl]acetamide |
| SMILES | Cc1ccc(-n2ncc3c2N(CC(=O)NC(C)(C)C)C(=O)N2CCN=C32)cc1 |
| InChI | InChI=1S/C20H24N6O2/c1-13-5-7-14(8-6-13)26-18-15(11-22-26)17-21-9-10-24(17)19(28)25(18)12-16(27)23-20(2,3)4/h5-8,11H,9-10,12H2,1-4H3,(H,23,27) |
| InChIKey | WLTPPAAYJKZATL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |