C19H24N2O3 — CID 92560038
3-[[(3S,7R,8aR)-7-hydroxy-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-6-methylchromen-4-one (PubChem CID 92560038) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[[(3S,7R,8aR)-7-hydroxy-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-6-methylchromen-4-one.
| Compound Name | 3-[[(3S,7R,8aR)-7-hydroxy-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-6-methylchromen-4-one |
|---|---|
| PubChem CID | 92560038 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 3-[[(3S,7R,8aR)-7-hydroxy-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-6-methylchromen-4-one |
| SMILES | Cc1ccc2occ(CN3C[C@H]4C[C@@H](O)CN4C[C@@H]3C)c(=O)c2c1 |
| InChI | InChI=1S/C19H24N2O3/c1-12-3-4-18-17(5-12)19(23)14(11-24-18)8-20-9-15-6-16(22)10-21(15)7-13(20)2/h3-5,11,13,15-16,22H,6-10H2,1-2H3/t13-,15+,16+/m0/s1 |
| InChIKey | DJUKZDXNQNBIMR-NUEKZKHPSA-N |
| XLogP | 1.74 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |