C20H24N4OS — CID 92562406
(3aS,4S,6aR)-2-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4-(3-methyl-2-pyridinyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 92562406) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is (3aS,4S,6aR)-2-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4-(3-methyl-2-pyridinyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aS,4S,6aR)-2-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4-(3-methyl-2-pyridinyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 92562406 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3aS,4S,6aR)-2-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4-(3-methyl-2-pyridinyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | Cc1cccnc1[C@]1(O)CC[C@H]2CN(Cc3c(C)nc4sccn34)C[C@H]21 |
| InChI | InChI=1S/C20H24N4OS/c1-13-4-3-7-21-18(13)20(25)6-5-15-10-23(11-16(15)20)12-17-14(2)22-19-24(17)8-9-26-19/h3-4,7-9,15-16,25H,5-6,10-12H2,1-2H3/t15-,16+,20-/m0/s1 |
| InChIKey | NKCMBOHXPKPSCW-YRNRMSPPSA-N |
| XLogP | 3.14 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |