C21H29N5O — CID 92562929
1-[(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-2-(4-methyltriazol-1-yl)ethanone (PubChem CID 92562929) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-[(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-2-(4-methyltriazol-1-yl)ethanone.
| Compound Name | 1-[(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-2-(4-methyltriazol-1-yl)ethanone |
|---|---|
| PubChem CID | 92562929 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 1-[(4R,4aR,9aR)-5-methyl-4-phenyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]-2-(4-methyltriazol-1-yl)ethanone |
| SMILES | Cc1cn(CC(=O)N2CC[C@H](c3ccccc3)[C@@H]3[C@H]2CCCCN3C)nn1 |
| InChI | InChI=1S/C21H29N5O/c1-16-14-25(23-22-16)15-20(27)26-13-11-18(17-8-4-3-5-9-17)21-19(26)10-6-7-12-24(21)2/h3-5,8-9,14,18-19,21H,6-7,10-13,15H2,1-2H3/t18-,19-,21-/m1/s1 |
| InChIKey | IQUBHYLOVGBPDS-SFHLNBCPSA-N |
| XLogP | 2.46 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |