About 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide
5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide (PubChem CID 92563065) has the molecular formula C15H14N4OS2
and a molecular weight of 330.44 g/mol. Its IUPAC name is 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide |
| PubChem CID | 92563065 |
| Molecular Formula | C15H14N4OS2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)N[C@H](Cc2cccs2)c2nccs2)cn1 |
| InChI | InChI=1S/C15H14N4OS2/c1-10-8-18-13(9-17-10)14(20)19-12(15-16-4-6-22-15)7-11-3-2-5-21-11/h2-6,8-9,12H,7H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | AQHGRIUCNFMYOZ-GFCCVEGCSA-N |
| XLogP | 3.02 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide?
The IUPAC name of 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide (CID 92563065) is 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide.
What is the SMILES notation for 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide?
The canonical SMILES for 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide is Cc1cnc(C(=O)N[C@H](Cc2cccs2)c2nccs2)cn1.
What is the InChIKey of 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide?
The InChIKey is AQHGRIUCNFMYOZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H14N4OS2/c1-10-8-18-13(9-17-10)14(20)19-12(15-16-4-6-22-15)7-11-3-2-5-21-11/h2-6,8-9,12H,7H2,1H3,(H,19,20)/t12-/m1/s1.
What are the key properties of 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide?
5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide has a molecular weight of 330.44 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)-2-thiophen-2-ylethyl]pyrazine-2-carboxamide is sourced from PubChem (CID 92563065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).