C18H20N6O3S — CID 92563289
2-[(2R)-2',4-dioxospiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-azepane]-1'-yl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 92563289) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[(2R)-2',4-dioxospiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-azepane]-1'-yl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(2R)-2',4-dioxospiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-azepane]-1'-yl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 92563289 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[(2R)-2',4-dioxospiro[1,3-dihydropyrido[2,3-d]pyrimidine-2,5'-azepane]-1'-yl]-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1cnc(NC(=O)CN2CC[C@@]3(CCC2=O)NC(=O)c2cccnc2N3)s1 |
| InChI | InChI=1S/C18H20N6O3S/c1-11-9-20-17(28-11)21-13(25)10-24-8-6-18(5-4-14(24)26)22-15-12(16(27)23-18)3-2-7-19-15/h2-3,7,9H,4-6,8,10H2,1H3,(H,19,22)(H,23,27)(H,20,21,25)/t18-/m1/s1 |
| InChIKey | QREZQYQBVBWGQK-GOSISDBHSA-N |
| XLogP | 1.35 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |