C17H16N2S2 — CID 92563962
(5S,7S)-5-(4-methyl-1,3-thiazol-2-yl)-7-phenyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine (PubChem CID 92563962) has the molecular formula C17H16N2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (5S,7S)-5-(4-methyl-1,3-thiazol-2-yl)-7-phenyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine.
| Compound Name | (5S,7S)-5-(4-methyl-1,3-thiazol-2-yl)-7-phenyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 92563962 |
| Molecular Formula | C17H16N2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (5S,7S)-5-(4-methyl-1,3-thiazol-2-yl)-7-phenyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine |
| SMILES | Cc1csc([C@@H]2Cc3ccsc3[C@H](c3ccccc3)N2)n1 |
| InChI | InChI=1S/C17H16N2S2/c1-11-10-21-17(18-11)14-9-13-7-8-20-16(13)15(19-14)12-5-3-2-4-6-12/h2-8,10,14-15,19H,9H2,1H3/t14-,15-/m0/s1 |
| InChIKey | PCFPAIYJERCRGA-GJZGRUSLSA-N |
| XLogP | 4.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |