C21H27N3OS — CID 92564172
3,5-dimethyl-7-[1-(3-phenoxypropyl)piperidin-4-yl]imidazo[5,1-b][1,3]thiazole (PubChem CID 92564172) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 3,5-dimethyl-7-[1-(3-phenoxypropyl)piperidin-4-yl]imidazo[5,1-b][1,3]thiazole.
| Compound Name | 3,5-dimethyl-7-[1-(3-phenoxypropyl)piperidin-4-yl]imidazo[5,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 92564172 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 3,5-dimethyl-7-[1-(3-phenoxypropyl)piperidin-4-yl]imidazo[5,1-b][1,3]thiazole |
| SMILES | Cc1csc2c(C3CCN(CCCOc4ccccc4)CC3)nc(C)n12 |
| InChI | InChI=1S/C21H27N3OS/c1-16-15-26-21-20(22-17(2)24(16)21)18-9-12-23(13-10-18)11-6-14-25-19-7-4-3-5-8-19/h3-5,7-8,15,18H,6,9-14H2,1-2H3 |
| InChIKey | LFKWXGRXFGUZBC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|