C25H26N4 — CID 92565018
N,7-dibenzyl-2-methyl-N-prop-2-ynyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 92565018) has the molecular formula C25H26N4 and a molecular weight of 382.51 g/mol. Its IUPAC name is N,7-dibenzyl-2-methyl-N-prop-2-ynyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N,7-dibenzyl-2-methyl-N-prop-2-ynyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 92565018 |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N,7-dibenzyl-2-methyl-N-prop-2-ynyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | C#CCN(Cc1ccccc1)c1nc(C)nc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C25H26N4/c1-3-15-29(18-22-12-8-5-9-13-22)25-23-14-16-28(17-21-10-6-4-7-11-21)19-24(23)26-20(2)27-25/h1,4-13H,14-19H2,2H3 |
| InChIKey | PHAWKSPEHLRBBC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|