C20H24N6O2 — CID 92565606
N-[[3-[4-(2-methylpyrimidin-4-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-2-morpholin-4-ylethanamine (PubChem CID 92565606) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[[3-[4-(2-methylpyrimidin-4-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[[3-[4-(2-methylpyrimidin-4-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 92565606 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[[3-[4-(2-methylpyrimidin-4-yl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-2-morpholin-4-ylethanamine |
| SMILES | Cc1nccc(-c2ccc(-c3noc(CNCCN4CCOCC4)n3)cc2)n1 |
| InChI | InChI=1S/C20H24N6O2/c1-15-22-7-6-18(23-15)16-2-4-17(5-3-16)20-24-19(28-25-20)14-21-8-9-26-10-12-27-13-11-26/h2-7,21H,8-14H2,1H3 |
| InChIKey | VKGIKHSCGPUCIX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|