C16H24N4O — CID 92565917
cyclohexyl-[(2R,6R)-12-methyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone (PubChem CID 92565917) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is cyclohexyl-[(2R,6R)-12-methyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone.
| Compound Name | cyclohexyl-[(2R,6R)-12-methyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone |
|---|---|
| PubChem CID | 92565917 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | cyclohexyl-[(2R,6R)-12-methyl-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-dien-4-yl]methanone |
| SMILES | Cc1nnc2n1[C@H]1CN(C(=O)C3CCCCC3)C[C@H]1CC2 |
| InChI | InChI=1S/C16H24N4O/c1-11-17-18-15-8-7-13-9-19(10-14(13)20(11)15)16(21)12-5-3-2-4-6-12/h12-14H,2-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | UNQWCLDGJVVUDG-KGLIPLIRSA-N |
| XLogP | 2.11 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |