About 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one
1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one (PubChem CID 92566414) has the molecular formula C19H27N5O2
and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one |
| PubChem CID | 92566414 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one |
| SMILES | Cn1nc(C2CCN(C(=O)CCN3CCOCC3)CC2)c2cccnc21 |
| InChI | InChI=1S/C19H27N5O2/c1-22-19-16(3-2-7-20-19)18(21-22)15-4-9-24(10-5-15)17(25)6-8-23-11-13-26-14-12-23/h2-3,7,15H,4-6,8-14H2,1H3 |
| InChIKey | KWMMSDWSNHTSIO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one?
The IUPAC name of 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one (CID 92566414) is 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one.
What is the SMILES notation for 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one?
The canonical SMILES for 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one is Cn1nc(C2CCN(C(=O)CCN3CCOCC3)CC2)c2cccnc21.
What is the InChIKey of 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one?
The InChIKey is KWMMSDWSNHTSIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N5O2/c1-22-19-16(3-2-7-20-19)18(21-22)15-4-9-24(10-5-15)17(25)6-8-23-11-13-26-14-12-23/h2-3,7,15H,4-6,8-14H2,1H3.
What are the key properties of 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one?
1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one has a molecular weight of 357.46 g/mol, XLogP of 1.40, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1-methylpyrazolo[3,4-b]pyridin-3-yl)piperidin-1-yl]-3-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 92566414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).