About (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine
(3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine (PubChem CID 92566888) has the molecular formula C13H18N4O2S
and a molecular weight of 294.38 g/mol. Its IUPAC name is (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine |
| PubChem CID | 92566888 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine |
| SMILES | Cn1cc([C@@H]2CN(S(C)(=O)=O)C[C@H]2N)c2ccncc21 |
| InChI | InChI=1S/C13H18N4O2S/c1-16-6-10(9-3-4-15-5-13(9)16)11-7-17(8-12(11)14)20(2,18)19/h3-6,11-12H,7-8,14H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | IJDNCRCIQNHTLL-NWDGAFQWSA-N |
| XLogP | 0.26 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine?
The IUPAC name of (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine (CID 92566888) is (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine.
What is the SMILES notation for (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine?
The canonical SMILES for (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine is Cn1cc([C@@H]2CN(S(C)(=O)=O)C[C@H]2N)c2ccncc21.
What is the InChIKey of (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine?
The InChIKey is IJDNCRCIQNHTLL-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H18N4O2S/c1-16-6-10(9-3-4-15-5-13(9)16)11-7-17(8-12(11)14)20(2,18)19/h3-6,11-12H,7-8,14H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine?
(3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine has a molecular weight of 294.38 g/mol, XLogP of 0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-(1-methylpyrrolo[2,3-c]pyridin-3-yl)-1-methylsulfonylpyrrolidin-3-amine is sourced from PubChem (CID 92566888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).