C17H15F2N3OS — CID 92568198
12-[(2,5-difluorophenyl)methyl]-4-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-2-one (PubChem CID 92568198) has the molecular formula C17H15F2N3OS and a molecular weight of 347.39 g/mol. Its IUPAC name is 12-[(2,5-difluorophenyl)methyl]-4-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-2-one.
| Compound Name | 12-[(2,5-difluorophenyl)methyl]-4-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-2-one |
|---|---|
| PubChem CID | 92568198 |
| Molecular Formula | C17H15F2N3OS |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 12-[(2,5-difluorophenyl)methyl]-4-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),5,8-trien-2-one |
| SMILES | O=c1c2sccc2nc2n1CCN(Cc1cc(F)ccc1F)CC2 |
| InChI | InChI=1S/C17H15F2N3OS/c18-12-1-2-13(19)11(9-12)10-21-5-3-15-20-14-4-8-24-16(14)17(23)22(15)7-6-21/h1-2,4,8-9H,3,5-7,10H2 |
| InChIKey | PIADEMGWYIDPBW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |