C19H20N4O2 — CID 9256860
2-(4-cyanophenoxy)-N-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]acetamide (PubChem CID 9256860) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 9256860 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[(Z)-1-[4-(dimethylamino)phenyl]ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)COc1ccc(C#N)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H20N4O2/c1-14(16-6-8-17(9-7-16)23(2)3)21-22-19(24)13-25-18-10-4-15(12-20)5-11-18/h4-11H,13H2,1-3H3,(H,22,24)/b21-14- |
| InChIKey | UKDZAHQMDACHRT-STZFKDTASA-N |
| XLogP | 2.54 |
| TPSA | 77.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|