C20H20N4O2 — CID 92570711
4-(oxan-4-yl)-N-(pyridin-3-ylmethyl)-1,6-naphthyridine-2-carboxamide (PubChem CID 92570711) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-(oxan-4-yl)-N-(pyridin-3-ylmethyl)-1,6-naphthyridine-2-carboxamide.
| Compound Name | 4-(oxan-4-yl)-N-(pyridin-3-ylmethyl)-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 92570711 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-(oxan-4-yl)-N-(pyridin-3-ylmethyl)-1,6-naphthyridine-2-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1cc(C2CCOCC2)c2cnccc2n1 |
| InChI | InChI=1S/C20H20N4O2/c25-20(23-12-14-2-1-6-21-11-14)19-10-16(15-4-8-26-9-5-15)17-13-22-7-3-18(17)24-19/h1-3,6-7,10-11,13,15H,4-5,8-9,12H2,(H,23,25) |
| InChIKey | QQSAUUIMINUBND-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |