C26H33N3O2 — CID 92570850
(3S)-1-(3-cyclopentylpropanoyl)-3-[(4-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 92570850) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (3S)-1-(3-cyclopentylpropanoyl)-3-[(4-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(3-cyclopentylpropanoyl)-3-[(4-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92570850 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (3S)-1-(3-cyclopentylpropanoyl)-3-[(4-pyridin-3-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(Cc2ccc(-c3cccnc3)cc2)CCCN(C(=O)CCC2CCCC2)C1 |
| InChI | InChI=1S/C26H33N3O2/c27-25(31)26(17-21-8-11-22(12-9-21)23-7-3-15-28-18-23)14-4-16-29(19-26)24(30)13-10-20-5-1-2-6-20/h3,7-9,11-12,15,18,20H,1-2,4-6,10,13-14,16-17,19H2,(H2,27,31)/t26-/m0/s1 |
| InChIKey | CHXYXFWISSJTTC-SANMLTNESA-N |
| XLogP | 4.36 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |