C19H20N6O2S — CID 92571410
2-(2-oxopyrrolidin-1-yl)-N-[2-(4-pyrazin-2-yl-5-thiophen-2-ylpyrazol-1-yl)ethyl]acetamide (PubChem CID 92571410) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is 2-(2-oxopyrrolidin-1-yl)-N-[2-(4-pyrazin-2-yl-5-thiophen-2-ylpyrazol-1-yl)ethyl]acetamide.
| Compound Name | 2-(2-oxopyrrolidin-1-yl)-N-[2-(4-pyrazin-2-yl-5-thiophen-2-ylpyrazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 92571410 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-(2-oxopyrrolidin-1-yl)-N-[2-(4-pyrazin-2-yl-5-thiophen-2-ylpyrazol-1-yl)ethyl]acetamide |
| SMILES | O=C(CN1CCCC1=O)NCCn1ncc(-c2cnccn2)c1-c1cccs1 |
| InChI | InChI=1S/C19H20N6O2S/c26-17(13-24-8-1-4-18(24)27)22-7-9-25-19(16-3-2-10-28-16)14(11-23-25)15-12-20-5-6-21-15/h2-3,5-6,10-12H,1,4,7-9,13H2,(H,22,26) |
| InChIKey | TXHVFFVCYZBBOO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |