C19H24N2O4 — CID 92571774
N-[(2R,3S)-2-cyclohexyl-6-oxopiperidin-3-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 92571774) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[(2R,3S)-2-cyclohexyl-6-oxopiperidin-3-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2R,3S)-2-cyclohexyl-6-oxopiperidin-3-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 92571774 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[(2R,3S)-2-cyclohexyl-6-oxopiperidin-3-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C1CC[C@H](NC(=O)c2ccc3c(c2)OCO3)[C@@H](C2CCCCC2)N1 |
| InChI | InChI=1S/C19H24N2O4/c22-17-9-7-14(18(21-17)12-4-2-1-3-5-12)20-19(23)13-6-8-15-16(10-13)25-11-24-15/h6,8,10,12,14,18H,1-5,7,9,11H2,(H,20,23)(H,21,22)/t14-,18+/m0/s1 |
| InChIKey | OCMGQLPUMWHYSZ-KBXCAEBGSA-N |
| XLogP | 2.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |