C22H19N5S — CID 9257193
3-methyl-4-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9257193) has the molecular formula C22H19N5S and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-methyl-4-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-methyl-4-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9257193 |
| Molecular Formula | C22H19N5S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-methyl-4-[(Z)-[4-(N-phenylanilino)phenyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1/N=C\c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N5S/c1-17-24-25-22(28)27(17)23-16-18-12-14-21(15-13-18)26(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-16H,1H3,(H,25,28)/b23-16- |
| InChIKey | IKOSSUWZMSGARH-KQWNVCNZSA-N |
| XLogP | 5.60 |
| TPSA | 49.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|