About 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one
6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one (PubChem CID 92572249) has the molecular formula C17H16N4O3
and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one.
Molecular Properties
| Compound Name | 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one |
| PubChem CID | 92572249 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one |
| SMILES | O=C(c1ccno1)N1CCC(c2cc3cccnc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C17H16N4O3/c22-16-15-12(2-1-6-18-15)10-13(20-16)11-4-8-21(9-5-11)17(23)14-3-7-19-24-14/h1-3,6-7,10-11H,4-5,8-9H2,(H,20,22) |
| InChIKey | ZAGIBYURUUCGQT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one?
The IUPAC name of 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one (CID 92572249) is 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one.
What is the SMILES notation for 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one?
The canonical SMILES for 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one is O=C(c1ccno1)N1CCC(c2cc3cccnc3c(=O)[nH]2)CC1.
What is the InChIKey of 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one?
The InChIKey is ZAGIBYURUUCGQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3/c22-16-15-12(2-1-6-18-15)10-13(20-16)11-4-8-21(9-5-11)17(23)14-3-7-19-24-14/h1-3,6-7,10-11H,4-5,8-9H2,(H,20,22).
What are the key properties of 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one?
6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one has a molecular weight of 324.34 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(1,2-oxazole-5-carbonyl)piperidin-4-yl]-7H-1,7-naphthyridin-8-one is sourced from PubChem (CID 92572249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).