About 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine
2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 92572827) has the molecular formula C19H20FN3
and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 92572827 |
| Molecular Formula | C19H20FN3 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Fc1ccccc1CN1CCC[C@@H](c2cc3cccnc3[nH]2)C1 |
| InChI | InChI=1S/C19H20FN3/c20-17-8-2-1-5-15(17)12-23-10-4-7-16(13-23)18-11-14-6-3-9-21-19(14)22-18/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | ZLEOOIZNIZLEQH-MRXNPFEDSA-N |
| XLogP | 4.08 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine (CID 92572827) is 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine is Fc1ccccc1CN1CCC[C@@H](c2cc3cccnc3[nH]2)C1.
What is the InChIKey of 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is ZLEOOIZNIZLEQH-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H20FN3/c20-17-8-2-1-5-15(17)12-23-10-4-7-16(13-23)18-11-14-6-3-9-21-19(14)22-18/h1-3,5-6,8-9,11,16H,4,7,10,12-13H2,(H,21,22)/t16-/m1/s1.
What are the key properties of 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine?
2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 309.39 g/mol, XLogP of 4.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 92572827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).