C25H36N2O2 — CID 92573788
4-[(3S,4S)-4-(4-methoxyphenyl)hexan-3-yl]-2-[(4-methylpiperazin-1-yl)methyl]phenol (PubChem CID 92573788) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 4-[(3S,4S)-4-(4-methoxyphenyl)hexan-3-yl]-2-[(4-methylpiperazin-1-yl)methyl]phenol.
| Compound Name | 4-[(3S,4S)-4-(4-methoxyphenyl)hexan-3-yl]-2-[(4-methylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 92573788 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 4-[(3S,4S)-4-(4-methoxyphenyl)hexan-3-yl]-2-[(4-methylpiperazin-1-yl)methyl]phenol |
| SMILES | CC[C@H](c1ccc(OC)cc1)[C@H](CC)c1ccc(O)c(CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C25H36N2O2/c1-5-23(19-7-10-22(29-4)11-8-19)24(6-2)20-9-12-25(28)21(17-20)18-27-15-13-26(3)14-16-27/h7-12,17,23-24,28H,5-6,13-16,18H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | ORAVMMPYPPCELG-DNQXCXABSA-N |
| XLogP | 4.84 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|