C22H21FN4O2 — CID 92573997
[5-amino-1-(4-fluorophenyl)pyrazol-4-yl]-[(3S)-1-benzoylpiperidin-3-yl]methanone (PubChem CID 92573997) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is [5-amino-1-(4-fluorophenyl)pyrazol-4-yl]-[(3S)-1-benzoylpiperidin-3-yl]methanone.
| Compound Name | [5-amino-1-(4-fluorophenyl)pyrazol-4-yl]-[(3S)-1-benzoylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 92573997 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [5-amino-1-(4-fluorophenyl)pyrazol-4-yl]-[(3S)-1-benzoylpiperidin-3-yl]methanone |
| SMILES | Nc1c(C(=O)[C@H]2CCCN(C(=O)c3ccccc3)C2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN4O2/c23-17-8-10-18(11-9-17)27-21(24)19(13-25-27)20(28)16-7-4-12-26(14-16)22(29)15-5-2-1-3-6-15/h1-3,5-6,8-11,13,16H,4,7,12,14,24H2/t16-/m0/s1 |
| InChIKey | PMTIXEBGCAOILF-INIZCTEOSA-N |
| XLogP | 3.33 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |