C21H26N2O — CID 92575003
(3R,7R,8aS)-2,3-dibenzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 92575003) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (3R,7R,8aS)-2,3-dibenzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3R,7R,8aS)-2,3-dibenzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 92575003 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3R,7R,8aS)-2,3-dibenzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3ccccc3)[C@H](Cc3ccccc3)CN2C1 |
| InChI | InChI=1S/C21H26N2O/c24-21-12-20-15-22(13-18-9-5-2-6-10-18)19(14-23(20)16-21)11-17-7-3-1-4-8-17/h1-10,19-21,24H,11-16H2/t19-,20+,21-/m1/s1 |
| InChIKey | NODBEUOYVUNKEU-QHAWAJNXSA-N |
| XLogP | 2.55 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |