C19H24N2OS — CID 92575017
(3S,7R,8aS)-3-benzyl-2-(thiophen-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 92575017) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is (3S,7R,8aS)-3-benzyl-2-(thiophen-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3S,7R,8aS)-3-benzyl-2-(thiophen-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 92575017 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (3S,7R,8aS)-3-benzyl-2-(thiophen-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3ccsc3)[C@@H](Cc3ccccc3)CN2C1 |
| InChI | InChI=1S/C19H24N2OS/c22-19-9-18-12-20(10-16-6-7-23-14-16)17(11-21(18)13-19)8-15-4-2-1-3-5-15/h1-7,14,17-19,22H,8-13H2/t17-,18-,19+/m0/s1 |
| InChIKey | DTPXCMUJTPLMIX-GBESFXJTSA-N |
| XLogP | 2.61 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |