C25H23FN4O2 — CID 92577098
[(3R,3aR,7aS)-3-(4-fluorophenyl)-1-(pyridine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone (PubChem CID 92577098) has the molecular formula C25H23FN4O2 and a molecular weight of 430.48 g/mol. Its IUPAC name is [(3R,3aR,7aS)-3-(4-fluorophenyl)-1-(pyridine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3R,3aR,7aS)-3-(4-fluorophenyl)-1-(pyridine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 92577098 |
| Molecular Formula | C25H23FN4O2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [(3R,3aR,7aS)-3-(4-fluorophenyl)-1-(pyridine-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CC[C@H]2[C@@H](C1)[C@H](c1ccc(F)cc1)CN2C(=O)c1ccccn1 |
| InChI | InChI=1S/C25H23FN4O2/c26-18-9-7-17(8-10-18)19-16-30(25(32)22-6-2-4-13-28-22)23-11-14-29(15-20(19)23)24(31)21-5-1-3-12-27-21/h1-10,12-13,19-20,23H,11,14-16H2/t19-,20-,23-/m0/s1 |
| InChIKey | DTTRNSGBPBQZPF-JTAQYXEDSA-N |
| XLogP | 3.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |