C24H28FN3O2 — CID 92577155
N-[(S)-[(3S)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-pyridin-2-ylmethyl]-3-fluorobenzamide (PubChem CID 92577155) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[(S)-[(3S)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-pyridin-2-ylmethyl]-3-fluorobenzamide.
| Compound Name | N-[(S)-[(3S)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-pyridin-2-ylmethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 92577155 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[(S)-[(3S)-1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-pyridin-2-ylmethyl]-3-fluorobenzamide |
| SMILES | O=C(N[C@H](c1ccccn1)[C@H]1CCCN(CC2=CCCOC2)C1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H28FN3O2/c25-21-9-3-7-19(14-21)24(29)27-23(22-10-1-2-11-26-22)20-8-4-12-28(16-20)15-18-6-5-13-30-17-18/h1-3,6-7,9-11,14,20,23H,4-5,8,12-13,15-17H2,(H,27,29)/t20-,23-/m0/s1 |
| InChIKey | KJUIGHUOUUAGGZ-REWPJTCUSA-N |
| XLogP | 3.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|