C18H29N5OS — CID 92577859
2-[(3S,8aR)-2-[(2-thiomorpholin-4-ylpyrimidin-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol (PubChem CID 92577859) has the molecular formula C18H29N5OS and a molecular weight of 363.53 g/mol. Its IUPAC name is 2-[(3S,8aR)-2-[(2-thiomorpholin-4-ylpyrimidin-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol.
| Compound Name | 2-[(3S,8aR)-2-[(2-thiomorpholin-4-ylpyrimidin-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol |
|---|---|
| PubChem CID | 92577859 |
| Molecular Formula | C18H29N5OS |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 2-[(3S,8aR)-2-[(2-thiomorpholin-4-ylpyrimidin-4-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol |
| SMILES | OCC[C@H]1CN2CCC[C@@H]2CN1Cc1ccnc(N2CCSCC2)n1 |
| InChI | InChI=1S/C18H29N5OS/c24-9-4-17-13-22-6-1-2-16(22)14-23(17)12-15-3-5-19-18(20-15)21-7-10-25-11-8-21/h3,5,16-17,24H,1-2,4,6-14H2/t16-,17+/m1/s1 |
| InChIKey | VIMOBRZNRROVRU-SJORKVTESA-N |
| XLogP | 1.06 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |