C18H24N6O — CID 92577959
(1R)-N-[2-[3-[(3S)-pyrrolidin-3-yl]pyrazolo[3,4-b]pyrazin-1-yl]ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 92577959) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is (1R)-N-[2-[3-[(3S)-pyrrolidin-3-yl]pyrazolo[3,4-b]pyrazin-1-yl]ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[2-[3-[(3S)-pyrrolidin-3-yl]pyrazolo[3,4-b]pyrazin-1-yl]ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 92577959 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1R)-N-[2-[3-[(3S)-pyrrolidin-3-yl]pyrazolo[3,4-b]pyrazin-1-yl]ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCCn1nc([C@H]2CCNC2)c2nccnc21)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C18H24N6O/c25-18(13-4-2-1-3-5-13)22-10-11-24-17-16(20-8-9-21-17)15(23-24)14-6-7-19-12-14/h1-2,8-9,13-14,19H,3-7,10-12H2,(H,22,25)/t13-,14-/m0/s1 |
| InChIKey | POHXILHRTPYKRY-KBPBESRZSA-N |
| XLogP | 1.38 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|