C17H26N4O — CID 92579124
5-tert-butyl-11-(2-methylpropyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 92579124) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-tert-butyl-11-(2-methylpropyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-tert-butyl-11-(2-methylpropyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 92579124 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 5-tert-butyl-11-(2-methylpropyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(C)CN1CCc2nc3cc(C(C)(C)C)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C17H26N4O/c1-11(2)9-20-7-6-13-12(10-20)16(22)21-15(18-13)8-14(19-21)17(3,4)5/h8,11,19H,6-7,9-10H2,1-5H3 |
| InChIKey | WKITXTBWVQKCLH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |