C25H31N5O2 — CID 92579316
5-[(2R)-1-(2-phenylacetyl)piperidin-2-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 92579316) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 5-[(2R)-1-(2-phenylacetyl)piperidin-2-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 5-[(2R)-1-(2-phenylacetyl)piperidin-2-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 92579316 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 5-[(2R)-1-(2-phenylacetyl)piperidin-2-yl]-11-propan-2-yl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | CC(C)N1CCc2nc3cc([C@H]4CCCCN4C(=O)Cc4ccccc4)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C25H31N5O2/c1-17(2)28-13-11-20-19(16-28)25(32)30-23(26-20)15-21(27-30)22-10-6-7-12-29(22)24(31)14-18-8-4-3-5-9-18/h3-5,8-9,15,17,22,27H,6-7,10-14,16H2,1-2H3/t22-/m1/s1 |
| InChIKey | ICIODLIRUIPELT-JOCHJYFZSA-N |
| XLogP | 3.09 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |