C22H30N4O — CID 92580771
[(4R,4aR,9aR)-4-phenyl-1,2,3,4,4a,6,7,8,9,9a-decahydropyrido[3,2-b]azepin-5-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone (PubChem CID 92580771) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is [(4R,4aR,9aR)-4-phenyl-1,2,3,4,4a,6,7,8,9,9a-decahydropyrido[3,2-b]azepin-5-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone.
| Compound Name | [(4R,4aR,9aR)-4-phenyl-1,2,3,4,4a,6,7,8,9,9a-decahydropyrido[3,2-b]azepin-5-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 92580771 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | [(4R,4aR,9aR)-4-phenyl-1,2,3,4,4a,6,7,8,9,9a-decahydropyrido[3,2-b]azepin-5-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2CCCC[C@H]3NCC[C@H](c4ccccc4)[C@H]32)n[nH]1 |
| InChI | InChI=1S/C22H30N4O/c1-15(2)19-14-20(25-24-19)22(27)26-13-7-6-10-18-21(26)17(11-12-23-18)16-8-4-3-5-9-16/h3-5,8-9,14-15,17-18,21,23H,6-7,10-13H2,1-2H3,(H,24,25)/t17-,18-,21-/m1/s1 |
| InChIKey | ODYZNVFIYZLJEZ-DBXWQHBBSA-N |
| XLogP | 3.67 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |