C20H21N3O4 — CID 92581169
(3R,4R,5S)-3-methyl-2,6-dioxo-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 92581169) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (3R,4R,5S)-3-methyl-2,6-dioxo-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (3R,4R,5S)-3-methyl-2,6-dioxo-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 92581169 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (3R,4R,5S)-3-methyl-2,6-dioxo-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-7-azatricyclo[6.4.0.03,5]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | CC(C)c1cc(CNC(=O)[C@@H]2[C@@H]3C(=O)Nc4ccccc4C(=O)[C@]23C)on1 |
| InChI | InChI=1S/C20H21N3O4/c1-10(2)14-8-11(27-23-14)9-21-18(25)15-16-19(26)22-13-7-5-4-6-12(13)17(24)20(15,16)3/h4-8,10,15-16H,9H2,1-3H3,(H,21,25)(H,22,26)/t15-,16+,20+/m0/s1 |
| InChIKey | QLJNBGGCJALMPB-RZQQEMMASA-N |
| XLogP | 2.50 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |