C22H27FN4O2 — CID 92581659
1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1-(1-propan-2-ylpyrazole-4-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]ethanone (PubChem CID 92581659) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1-(1-propan-2-ylpyrazole-4-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]ethanone.
| Compound Name | 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1-(1-propan-2-ylpyrazole-4-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]ethanone |
|---|---|
| PubChem CID | 92581659 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-[(3S,3aR,7aR)-3-(4-fluorophenyl)-1-(1-propan-2-ylpyrazole-4-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H]2[C@H]1[C@@H](c1ccc(F)cc1)CN2C(=O)c1cnn(C(C)C)c1 |
| InChI | InChI=1S/C22H27FN4O2/c1-14(2)27-12-17(11-24-27)22(29)26-13-19(16-6-8-18(23)9-7-16)21-20(26)5-4-10-25(21)15(3)28/h6-9,11-12,14,19-21H,4-5,10,13H2,1-3H3/t19-,20-,21-/m1/s1 |
| InChIKey | AVAJDXZLHOEZLI-NJDAHSKKSA-N |
| XLogP | 3.22 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |